Products for Research Use Only

2'-F-CDP

CAT: 0931-TSW-00957-01Size: 10 mgDry Ice: NoHazardous: No
Product image 1
1 / 1
CAT#:0931-TSW-00957-01Size:10 mg
Selected
24/48H Stock Items & 2 to 6 Weeks non Stock Items.
Quick Request Actions
CAS Number
63555-61-3
Target
Nucleoside Antimetabolite/Analog
Related Pathways
Cell Cycle/Checkpoint, DNA Damage/DNA Repair
Bioactivity
2'-F-CDP is a nucleotide analog that can be utilized in the synthesis of oligonucleotides.
Smiles
F[C@H]1[C@@H](O[C@H](COP(OP(=O)(O)O)(=O)O)[C@H]1O)N2C(=O)N=C(N)C=C2
Molecular Formula
C9H14FN3O10P2
Molecular Weight
405.17
Shipping Conditions
Ice Packs
Storage Temperature
-20°C

Alternative Products

CatalogName
HY-1715252'-F-CDP
124816CDS2 (Phosphatidate Cytidylyltransferase 2, CDP-DAG Synthase 2, CDP-DG Synthase 2, CDP-diacylglycerol Synthase 2, CDS 2, CDP-diglyceride Pyrophosphorylase 2, CDP-diglyceride Synthase 2, CTP:Phosphatidate Cytidylyltransferase 2)
124816-FITCCDS2 (Phosphatidate Cytidylyltransferase 2, CDP-DAG Synthase 2, CDP-DG Synthase 2, CDP-diacylglycerol Synthase 2, CDS 2, CDP-diglyceride Pyrophosphorylase 2, CDP-diglyceride Synthase 2, CTP:Phosphatidate Cytidylyltransferase 2) (FITC)
MBS6151740-01CDS2 (Phosphatidate Cytidylyltransferase 2, CDP-DAG Synthase 2, CDP-DG Synthase 2, CDP-diacylglycerol Synthase 2, CDS 2, CDP-diglyceride Pyrophosphorylase 2, CDP-diglyceride Synthase 2, CTP:Phosphatidate Cytidylyltransferase 2) (HRP)
MBS6130528-01CDS2 (Phosphatidate Cytidylyltransferase 2, CDP-DAG Synthase 2, CDP-DG Synthase 2, CDP-diacylglycerol Synthase 2, CDS 2, CDP-diglyceride Pyrophosphorylase 2, CDP-diglyceride Synthase 2, CTP:Phosphatidate Cytidylyltransferase 2) (AP)
MBS6009898-01CDS2, ID (CDS2, Phosphatidate cytidylyltransferase 2, CDP-DAG synthase 2, CDP-DG synthase 2, CDP-diacylglycerol synthase 2, CDP-diglyceride pyrophosphorylase 2, CDP-diglyceride synthase 2, CTP:phosphatidate cytidylyltransferase 2)
124816-PECDS2 (Phosphatidate Cytidylyltransferase 2, CDP-DAG Synthase 2, CDP-DG Synthase 2, CDP-diacylglycerol Synthase 2, CDS 2, CDP-diglyceride Pyrophosphorylase 2, CDP-diglyceride Synthase 2, CTP:Phosphatidate Cytidylyltransferase 2) (PE)
MBS6135831-01CDS2 (Phosphatidate Cytidylyltransferase 2, CDP-DAG Synthase 2, CDP-DG Synthase 2, CDP-diacylglycerol Synthase 2, CDS 2, CDP-diglyceride Pyrophosphorylase 2, CDP-diglyceride Synthase 2, CTP:Phosphatidate Cytidylyltransferase 2) APC
124816-APCCDS2 (Phosphatidate Cytidylyltransferase 2, CDP-DAG Synthase 2, CDP-DG Synthase 2, CDP-diacylglycerol Synthase 2, CDS 2, CDP-diglyceride Pyrophosphorylase 2, CDP-diglyceride Synthase 2, CTP:Phosphatidate Cytidylyltransferase 2) (APC)
124816-BiotinCDS2 (Phosphatidate Cytidylyltransferase 2, CDP-DAG Synthase 2, CDP-DG Synthase 2, CDP-diacylglycerol Synthase 2, CDS 2, CDP-diglyceride Pyrophosphorylase 2, CDP-diglyceride Synthase 2, CTP:Phosphatidate Cytidylyltransferase 2) (Biotin)

Popular Products